C14H29N3OS — CID 57139537
2-[(1-propan-2-ylpiperidin-4-yl)methoxy]butylthiourea (PubChem CID 57139537) has the molecular formula C14H29N3OS and a molecular weight of 287.47 g/mol. Its IUPAC name is 2-[(1-propan-2-ylpiperidin-4-yl)methoxy]butylthiourea.
| Compound Name | 2-[(1-propan-2-ylpiperidin-4-yl)methoxy]butylthiourea |
|---|---|
| PubChem CID | 57139537 |
| Molecular Formula | C14H29N3OS |
| Molecular Weight | 287.47 g/mol |
| Exact Mass | 287.20 |
| IUPAC Name | 2-[(1-propan-2-ylpiperidin-4-yl)methoxy]butylthiourea |
| SMILES | CCC(CNC(N)=S)OCC1CCN(C(C)C)CC1 |
| InChI | InChI=1S/C14H29N3OS/c1-4-13(9-16-14(15)19)18-10-12-5-7-17(8-6-12)11(2)3/h11-13H,4-10H2,1-3H3,(H3,15,16,19) |
| InChIKey | QITNWOFFURXCEV-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.47 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|