C15H19F3N2OS — CID 26536409
1-[[(2S)-oxolan-2-yl]methyl]-3-[2-[4-(trifluoromethyl)phenyl]ethyl]thiourea (PubChem CID 26536409) has the molecular formula C15H19F3N2OS and a molecular weight of 332.39 g/mol. Its IUPAC name is 1-[[(2S)-oxolan-2-yl]methyl]-3-[2-[4-(trifluoromethyl)phenyl]ethyl]thiourea.
| Compound Name | 1-[[(2S)-oxolan-2-yl]methyl]-3-[2-[4-(trifluoromethyl)phenyl]ethyl]thiourea |
|---|---|
| PubChem CID | 26536409 |
| Molecular Formula | C15H19F3N2OS |
| Molecular Weight | 332.39 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | 1-[[(2S)-oxolan-2-yl]methyl]-3-[2-[4-(trifluoromethyl)phenyl]ethyl]thiourea |
| SMILES | FC(F)(F)c1ccc(CCNC(=S)NC[C@@H]2CCCO2)cc1 |
| InChI | InChI=1S/C15H19F3N2OS/c16-15(17,18)12-5-3-11(4-6-12)7-8-19-14(22)20-10-13-2-1-9-21-13/h3-6,13H,1-2,7-10H2,(H2,19,20,22)/t13-/m0/s1 |
| InChIKey | DIDMTYYDXWAJKG-ZDUSSCGKSA-N |
| XLogP | 2.89 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.39 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|