C13H17FN2OS — CID 7944327
1-[(2-fluorophenyl)methyl]-3-[[(2R)-oxolan-2-yl]methyl]thiourea (PubChem CID 7944327) has the molecular formula C13H17FN2OS and a molecular weight of 268.36 g/mol. Its IUPAC name is 1-[(2-fluorophenyl)methyl]-3-[[(2R)-oxolan-2-yl]methyl]thiourea.
| Compound Name | 1-[(2-fluorophenyl)methyl]-3-[[(2R)-oxolan-2-yl]methyl]thiourea |
|---|---|
| PubChem CID | 7944327 |
| Molecular Formula | C13H17FN2OS |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | 1-[(2-fluorophenyl)methyl]-3-[[(2R)-oxolan-2-yl]methyl]thiourea |
| SMILES | Fc1ccccc1CNC(=S)NC[C@H]1CCCO1 |
| InChI | InChI=1S/C13H17FN2OS/c14-12-6-2-1-4-10(12)8-15-13(18)16-9-11-5-3-7-17-11/h1-2,4,6,11H,3,5,7-9H2,(H2,15,16,18)/t11-/m1/s1 |
| InChIKey | SKDSFJHAFCFUKV-LLVKDONJSA-N |
| XLogP | 1.97 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|