C17H20ClN3O4S2 — CID 2655774
N-(3-chloro-4-methoxyphenyl)-2-(4-thiophen-2-ylsulfonylpiperazin-1-yl)acetamide (PubChem CID 2655774) has the molecular formula C17H20ClN3O4S2 and a molecular weight of 429.95 g/mol. Its IUPAC name is N-(3-chloro-4-methoxyphenyl)-2-(4-thiophen-2-ylsulfonylpiperazin-1-yl)acetamide.
| Compound Name | N-(3-chloro-4-methoxyphenyl)-2-(4-thiophen-2-ylsulfonylpiperazin-1-yl)acetamide |
|---|---|
| PubChem CID | 2655774 |
| Molecular Formula | C17H20ClN3O4S2 |
| Molecular Weight | 429.95 g/mol |
| Exact Mass | 429.06 |
| IUPAC Name | N-(3-chloro-4-methoxyphenyl)-2-(4-thiophen-2-ylsulfonylpiperazin-1-yl)acetamide |
| SMILES | COc1ccc(NC(=O)CN2CCN(S(=O)(=O)c3cccs3)CC2)cc1Cl |
| InChI | InChI=1S/C17H20ClN3O4S2/c1-25-15-5-4-13(11-14(15)18)19-16(22)12-20-6-8-21(9-7-20)27(23,24)17-3-2-10-26-17/h2-5,10-11H,6-9,12H2,1H3,(H,19,22) |
| InChIKey | RJXVKBLHTOBXCH-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.95 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |