C21H24Cl2N2O3S — CID 5062094
2-(3-chloro-N-(2-chloroacetyl)-4-methoxyanilino)-N-cyclohexyl-2-thiophen-2-ylacetamide (PubChem CID 5062094) has the molecular formula C21H24Cl2N2O3S and a molecular weight of 455.41 g/mol. Its IUPAC name is 2-(3-chloro-N-(2-chloroacetyl)-4-methoxyanilino)-N-cyclohexyl-2-thiophen-2-ylacetamide.
| Compound Name | 2-(3-chloro-N-(2-chloroacetyl)-4-methoxyanilino)-N-cyclohexyl-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 5062094 |
| Molecular Formula | C21H24Cl2N2O3S |
| Molecular Weight | 455.41 g/mol |
| Exact Mass | 454.09 |
| IUPAC Name | 2-(3-chloro-N-(2-chloroacetyl)-4-methoxyanilino)-N-cyclohexyl-2-thiophen-2-ylacetamide |
| SMILES | COc1ccc(N(C(=O)CCl)C(C(=O)NC2CCCCC2)c2cccs2)cc1Cl |
| InChI | InChI=1S/C21H24Cl2N2O3S/c1-28-17-10-9-15(12-16(17)23)25(19(26)13-22)20(18-8-5-11-29-18)21(27)24-14-6-3-2-4-7-14/h5,8-12,14,20H,2-4,6-7,13H2,1H3,(H,24,27) |
| InChIKey | KBKXZZVCONLGAX-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.41 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|