C18H20ClN4O5+ — CID 2658205
[2-(5-chloro-2-methoxyanilino)-2-oxoethyl]-methyl-[2-(3-nitroanilino)-2-oxoethyl]azanium (PubChem CID 2658205) has the molecular formula C18H20ClN4O5+ and a molecular weight of 407.83 g/mol. Its IUPAC name is [2-(5-chloro-2-methoxyanilino)-2-oxoethyl]-methyl-[2-(3-nitroanilino)-2-oxoethyl]azanium.
| Compound Name | [2-(5-chloro-2-methoxyanilino)-2-oxoethyl]-methyl-[2-(3-nitroanilino)-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 2658205 |
| Molecular Formula | C18H20ClN4O5+ |
| Molecular Weight | 407.83 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | [2-(5-chloro-2-methoxyanilino)-2-oxoethyl]-methyl-[2-(3-nitroanilino)-2-oxoethyl]azanium |
| SMILES | COc1ccc(Cl)cc1NC(=O)C[NH+](C)CC(=O)Nc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H19ClN4O5/c1-22(10-17(24)20-13-4-3-5-14(9-13)23(26)27)11-18(25)21-15-8-12(19)6-7-16(15)28-2/h3-9H,10-11H2,1-2H3,(H,20,24)(H,21,25)/p+1 |
| InChIKey | ORBKILDGODNZPI-UHFFFAOYSA-O |
| XLogP | 1.35 |
| TPSA | 115.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.83 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|