C24H26N4O3 — CID 26624665
(3S)-3'-[2-(4-benzylpiperazin-1-yl)-2-oxoethyl]spiro[1,2-dihydroindene-3,5'-imidazolidine]-2',4'-dione (PubChem CID 26624665) has the molecular formula C24H26N4O3 and a molecular weight of 418.50 g/mol. Its IUPAC name is (3S)-3'-[2-(4-benzylpiperazin-1-yl)-2-oxoethyl]spiro[1,2-dihydroindene-3,5'-imidazolidine]-2',4'-dione.
| Compound Name | (3S)-3'-[2-(4-benzylpiperazin-1-yl)-2-oxoethyl]spiro[1,2-dihydroindene-3,5'-imidazolidine]-2',4'-dione |
|---|---|
| PubChem CID | 26624665 |
| Molecular Formula | C24H26N4O3 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | (3S)-3'-[2-(4-benzylpiperazin-1-yl)-2-oxoethyl]spiro[1,2-dihydroindene-3,5'-imidazolidine]-2',4'-dione |
| SMILES | O=C(CN1C(=O)N[C@]2(CCc3ccccc32)C1=O)N1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C24H26N4O3/c29-21(27-14-12-26(13-15-27)16-18-6-2-1-3-7-18)17-28-22(30)24(25-23(28)31)11-10-19-8-4-5-9-20(19)24/h1-9H,10-17H2,(H,25,31)/t24-/m0/s1 |
| InChIKey | HAQFYCZEAJKCJV-DEOSSOPVSA-N |
| XLogP | 1.72 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|