C25H31N3O4S — CID 26635686
N-[4-[2,5-dimethyl-1-[[(2R)-oxolan-2-yl]methyl]pyrrol-3-yl]-1,3-thiazol-2-yl]-4-(4-methoxyphenoxy)butanamide (PubChem CID 26635686) has the molecular formula C25H31N3O4S and a molecular weight of 469.61 g/mol. Its IUPAC name is N-[4-[2,5-dimethyl-1-[[(2R)-oxolan-2-yl]methyl]pyrrol-3-yl]-1,3-thiazol-2-yl]-4-(4-methoxyphenoxy)butanamide.
| Compound Name | N-[4-[2,5-dimethyl-1-[[(2R)-oxolan-2-yl]methyl]pyrrol-3-yl]-1,3-thiazol-2-yl]-4-(4-methoxyphenoxy)butanamide |
|---|---|
| PubChem CID | 26635686 |
| Molecular Formula | C25H31N3O4S |
| Molecular Weight | 469.61 g/mol |
| Exact Mass | 469.20 |
| IUPAC Name | N-[4-[2,5-dimethyl-1-[[(2R)-oxolan-2-yl]methyl]pyrrol-3-yl]-1,3-thiazol-2-yl]-4-(4-methoxyphenoxy)butanamide |
| SMILES | COc1ccc(OCCCC(=O)Nc2nc(-c3cc(C)n(C[C@H]4CCCO4)c3C)cs2)cc1 |
| InChI | InChI=1S/C25H31N3O4S/c1-17-14-22(18(2)28(17)15-21-6-4-12-32-21)23-16-33-25(26-23)27-24(29)7-5-13-31-20-10-8-19(30-3)9-11-20/h8-11,14,16,21H,4-7,12-13,15H2,1-3H3,(H,26,27,29)/t21-/m1/s1 |
| InChIKey | DXLJOVRDCYYCPJ-OAQYLSRUSA-N |
| XLogP | 5.21 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.61 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|