C21H23N3O3S — CID 2114553
(E)-N-[4-[2,5-dimethyl-1-[[(2S)-oxolan-2-yl]methyl]pyrrol-3-yl]-1,3-thiazol-2-yl]-3-(furan-2-yl)prop-2-enamide (PubChem CID 2114553) has the molecular formula C21H23N3O3S and a molecular weight of 397.50 g/mol. Its IUPAC name is (E)-N-[4-[2,5-dimethyl-1-[[(2S)-oxolan-2-yl]methyl]pyrrol-3-yl]-1,3-thiazol-2-yl]-3-(furan-2-yl)prop-2-enamide.
| Compound Name | (E)-N-[4-[2,5-dimethyl-1-[[(2S)-oxolan-2-yl]methyl]pyrrol-3-yl]-1,3-thiazol-2-yl]-3-(furan-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 2114553 |
| Molecular Formula | C21H23N3O3S |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | (E)-N-[4-[2,5-dimethyl-1-[[(2S)-oxolan-2-yl]methyl]pyrrol-3-yl]-1,3-thiazol-2-yl]-3-(furan-2-yl)prop-2-enamide |
| SMILES | Cc1cc(-c2csc(NC(=O)/C=C/c3ccco3)n2)c(C)n1C[C@@H]1CCCO1 |
| InChI | InChI=1S/C21H23N3O3S/c1-14-11-18(15(2)24(14)12-17-6-4-10-27-17)19-13-28-21(22-19)23-20(25)8-7-16-5-3-9-26-16/h3,5,7-9,11,13,17H,4,6,10,12H2,1-2H3,(H,22,23,25)/b8-7+/t17-/m0/s1 |
| InChIKey | XFIWOSUPYYZPOE-OZSKJFCKSA-N |
| XLogP | 4.65 |
| TPSA | 69.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|