C25H19FN2O4S — CID 26646011
[4-[(2-methoxybenzoyl)amino]phenyl] 2-[2-(3-fluorophenyl)-1,3-thiazol-4-yl]acetate (PubChem CID 26646011) has the molecular formula C25H19FN2O4S and a molecular weight of 462.50 g/mol. Its IUPAC name is [4-[(2-methoxybenzoyl)amino]phenyl] 2-[2-(3-fluorophenyl)-1,3-thiazol-4-yl]acetate.
| Compound Name | [4-[(2-methoxybenzoyl)amino]phenyl] 2-[2-(3-fluorophenyl)-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 26646011 |
| Molecular Formula | C25H19FN2O4S |
| Molecular Weight | 462.50 g/mol |
| Exact Mass | 462.10 |
| IUPAC Name | [4-[(2-methoxybenzoyl)amino]phenyl] 2-[2-(3-fluorophenyl)-1,3-thiazol-4-yl]acetate |
| SMILES | COc1ccccc1C(=O)Nc1ccc(OC(=O)Cc2csc(-c3cccc(F)c3)n2)cc1 |
| InChI | InChI=1S/C25H19FN2O4S/c1-31-22-8-3-2-7-21(22)24(30)27-18-9-11-20(12-10-18)32-23(29)14-19-15-33-25(28-19)16-5-4-6-17(26)13-16/h2-13,15H,14H2,1H3,(H,27,30) |
| InChIKey | AXOZEMFDPQAOGP-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.50 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|