C16H13BrClN5O — CID 26685438
N-(4-bromo-2-methylphenyl)-2-[5-(4-chlorophenyl)tetrazol-2-yl]acetamide (PubChem CID 26685438) has the molecular formula C16H13BrClN5O and a molecular weight of 406.67 g/mol. Its IUPAC name is N-(4-bromo-2-methylphenyl)-2-[5-(4-chlorophenyl)tetrazol-2-yl]acetamide.
| Compound Name | N-(4-bromo-2-methylphenyl)-2-[5-(4-chlorophenyl)tetrazol-2-yl]acetamide |
|---|---|
| PubChem CID | 26685438 |
| Molecular Formula | C16H13BrClN5O |
| Molecular Weight | 406.67 g/mol |
| Exact Mass | 405.00 |
| IUPAC Name | N-(4-bromo-2-methylphenyl)-2-[5-(4-chlorophenyl)tetrazol-2-yl]acetamide |
| SMILES | Cc1cc(Br)ccc1NC(=O)Cn1nnc(-c2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C16H13BrClN5O/c1-10-8-12(17)4-7-14(10)19-15(24)9-23-21-16(20-22-23)11-2-5-13(18)6-3-11/h2-8H,9H2,1H3,(H,19,24) |
| InChIKey | USNWOXLTLIUZHY-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.67 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |