C14H12N4 — CID 26707
3,6-diphenyl-1,4-dihydro-1,2,4,5-tetrazine (PubChem CID 26707) has the molecular formula C14H12N4 and a molecular weight of 236.28 g/mol. Its IUPAC name is 3,6-diphenyl-1,4-dihydro-1,2,4,5-tetrazine.
| Compound Name | 3,6-diphenyl-1,4-dihydro-1,2,4,5-tetrazine |
|---|---|
| PubChem CID | 26707 |
| Molecular Formula | C14H12N4 |
| Molecular Weight | 236.28 g/mol |
| Exact Mass | 236.11 |
| IUPAC Name | 3,6-diphenyl-1,4-dihydro-1,2,4,5-tetrazine |
| SMILES | c1ccc(C2=NNC(c3ccccc3)=NN2)cc1 |
| InChI | InChI=1S/C14H12N4/c1-3-7-11(8-4-1)13-15-17-14(18-16-13)12-9-5-2-6-10-12/h1-10H,(H,15,16)(H,17,18) |
| InChIKey | VEYRTZVLYXCVCX-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 48.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.28 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |