C22H22F3N5O2S — CID 2670727
1-[2-[2,5-dimethyl-1-(2,2,2-trifluoroethyl)pyrrol-3-yl]-2-oxoethyl]sulfanyl-4-propyl-[1,2,4]triazolo[4,3-a]quinazolin-5-one (PubChem CID 2670727) has the molecular formula C22H22F3N5O2S and a molecular weight of 477.51 g/mol. Its IUPAC name is 1-[2-[2,5-dimethyl-1-(2,2,2-trifluoroethyl)pyrrol-3-yl]-2-oxoethyl]sulfanyl-4-propyl-[1,2,4]triazolo[4,3-a]quinazolin-5-one.
| Compound Name | 1-[2-[2,5-dimethyl-1-(2,2,2-trifluoroethyl)pyrrol-3-yl]-2-oxoethyl]sulfanyl-4-propyl-[1,2,4]triazolo[4,3-a]quinazolin-5-one |
|---|---|
| PubChem CID | 2670727 |
| Molecular Formula | C22H22F3N5O2S |
| Molecular Weight | 477.51 g/mol |
| Exact Mass | 477.14 |
| IUPAC Name | 1-[2-[2,5-dimethyl-1-(2,2,2-trifluoroethyl)pyrrol-3-yl]-2-oxoethyl]sulfanyl-4-propyl-[1,2,4]triazolo[4,3-a]quinazolin-5-one |
| SMILES | CCCn1c(=O)c2ccccc2n2c(SCC(=O)c3cc(C)n(CC(F)(F)F)c3C)nnc12 |
| InChI | InChI=1S/C22H22F3N5O2S/c1-4-9-28-19(32)15-7-5-6-8-17(15)30-20(28)26-27-21(30)33-11-18(31)16-10-13(2)29(14(16)3)12-22(23,24)25/h5-8,10H,4,9,11-12H2,1-3H3 |
| InChIKey | QIDKBPRDXJLOGM-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.51 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |