C29H28F3N5O2S — CID 98405846
4-[4-[(2R)-butan-2-yl]phenyl]-1-[2-[2,5-dimethyl-1-(2,2,2-trifluoroethyl)pyrrol-3-yl]-2-oxoethyl]sulfanyl-[1,2,4]triazolo[4,3-a]quinazolin-5-one (PubChem CID 98405846) has the molecular formula C29H28F3N5O2S and a molecular weight of 567.64 g/mol. Its IUPAC name is 4-[4-[(2R)-butan-2-yl]phenyl]-1-[2-[2,5-dimethyl-1-(2,2,2-trifluoroethyl)pyrrol-3-yl]-2-oxoethyl]sulfanyl-[1,2,4]triazolo[4,3-a]quinazolin-5-one.
| Compound Name | 4-[4-[(2R)-butan-2-yl]phenyl]-1-[2-[2,5-dimethyl-1-(2,2,2-trifluoroethyl)pyrrol-3-yl]-2-oxoethyl]sulfanyl-[1,2,4]triazolo[4,3-a]quinazolin-5-one |
|---|---|
| PubChem CID | 98405846 |
| Molecular Formula | C29H28F3N5O2S |
| Molecular Weight | 567.64 g/mol |
| Exact Mass | 567.19 |
| IUPAC Name | 4-[4-[(2R)-butan-2-yl]phenyl]-1-[2-[2,5-dimethyl-1-(2,2,2-trifluoroethyl)pyrrol-3-yl]-2-oxoethyl]sulfanyl-[1,2,4]triazolo[4,3-a]quinazolin-5-one |
| SMILES | CC[C@@H](C)c1ccc(-n2c(=O)c3ccccc3n3c(SCC(=O)c4cc(C)n(CC(F)(F)F)c4C)nnc23)cc1 |
| InChI | InChI=1S/C29H28F3N5O2S/c1-5-17(2)20-10-12-21(13-11-20)36-26(39)22-8-6-7-9-24(22)37-27(36)33-34-28(37)40-15-25(38)23-14-18(3)35(19(23)4)16-29(30,31)32/h6-14,17H,5,15-16H2,1-4H3/t17-/m1/s1 |
| InChIKey | YALZYEPZDIFZKR-QGZVFWFLSA-N |
| XLogP | 6.50 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.64 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |