C19H21FN4O4S2 — CID 26739568
1-(2-fluorophenyl)-3-[[(2S)-1-(4-methoxyphenyl)sulfonylpyrrolidine-2-carbonyl]amino]thiourea (PubChem CID 26739568) has the molecular formula C19H21FN4O4S2 and a molecular weight of 452.53 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-3-[[(2S)-1-(4-methoxyphenyl)sulfonylpyrrolidine-2-carbonyl]amino]thiourea.
| Compound Name | 1-(2-fluorophenyl)-3-[[(2S)-1-(4-methoxyphenyl)sulfonylpyrrolidine-2-carbonyl]amino]thiourea |
|---|---|
| PubChem CID | 26739568 |
| Molecular Formula | C19H21FN4O4S2 |
| Molecular Weight | 452.53 g/mol |
| Exact Mass | 452.10 |
| IUPAC Name | 1-(2-fluorophenyl)-3-[[(2S)-1-(4-methoxyphenyl)sulfonylpyrrolidine-2-carbonyl]amino]thiourea |
| SMILES | COc1ccc(S(=O)(=O)N2CCC[C@H]2C(=O)NNC(=S)Nc2ccccc2F)cc1 |
| InChI | InChI=1S/C19H21FN4O4S2/c1-28-13-8-10-14(11-9-13)30(26,27)24-12-4-7-17(24)18(25)22-23-19(29)21-16-6-3-2-5-15(16)20/h2-3,5-6,8-11,17H,4,7,12H2,1H3,(H,22,25)(H2,21,23,29)/t17-/m0/s1 |
| InChIKey | DMSQSWMGNDQXPU-KRWDZBQOSA-N |
| XLogP | 2.01 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.53 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|