C23H17ClN4O5 — CID 26741891
(1R)-7-chloro-2-(3-imidazol-1-ylpropyl)-1-(4-nitrophenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 26741891) has the molecular formula C23H17ClN4O5 and a molecular weight of 464.87 g/mol. Its IUPAC name is (1R)-7-chloro-2-(3-imidazol-1-ylpropyl)-1-(4-nitrophenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | (1R)-7-chloro-2-(3-imidazol-1-ylpropyl)-1-(4-nitrophenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 26741891 |
| Molecular Formula | C23H17ClN4O5 |
| Molecular Weight | 464.87 g/mol |
| Exact Mass | 464.09 |
| IUPAC Name | (1R)-7-chloro-2-(3-imidazol-1-ylpropyl)-1-(4-nitrophenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | O=C1c2oc3ccc(Cl)cc3c(=O)c2[C@@H](c2ccc([N+](=O)[O-])cc2)N1CCCn1ccnc1 |
| InChI | InChI=1S/C23H17ClN4O5/c24-15-4-7-18-17(12-15)21(29)19-20(14-2-5-16(6-3-14)28(31)32)27(23(30)22(19)33-18)10-1-9-26-11-8-25-13-26/h2-8,11-13,20H,1,9-10H2/t20-/m1/s1 |
| InChIKey | PHYOHKSBPPWGHP-HXUWFJFHSA-N |
| XLogP | 4.19 |
| TPSA | 111.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.87 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|