C24H23F3N4O — CID 26743422
1-[(1S,4S)-4-[3,5-dimethyl-1-[4-(trifluoromethyl)phenyl]pyrazol-4-yl]cyclopent-2-en-1-yl]-3-phenylurea (PubChem CID 26743422) has the molecular formula C24H23F3N4O and a molecular weight of 440.47 g/mol. Its IUPAC name is 1-[(1S,4S)-4-[3,5-dimethyl-1-[4-(trifluoromethyl)phenyl]pyrazol-4-yl]cyclopent-2-en-1-yl]-3-phenylurea.
| Compound Name | 1-[(1S,4S)-4-[3,5-dimethyl-1-[4-(trifluoromethyl)phenyl]pyrazol-4-yl]cyclopent-2-en-1-yl]-3-phenylurea |
|---|---|
| PubChem CID | 26743422 |
| Molecular Formula | C24H23F3N4O |
| Molecular Weight | 440.47 g/mol |
| Exact Mass | 440.18 |
| IUPAC Name | 1-[(1S,4S)-4-[3,5-dimethyl-1-[4-(trifluoromethyl)phenyl]pyrazol-4-yl]cyclopent-2-en-1-yl]-3-phenylurea |
| SMILES | Cc1nn(-c2ccc(C(F)(F)F)cc2)c(C)c1[C@@H]1C=C[C@@H](NC(=O)Nc2ccccc2)C1 |
| InChI | InChI=1S/C24H23F3N4O/c1-15-22(16(2)31(30-15)21-12-9-18(10-13-21)24(25,26)27)17-8-11-20(14-17)29-23(32)28-19-6-4-3-5-7-19/h3-13,17,20H,14H2,1-2H3,(H2,28,29,32)/t17-,20-/m1/s1 |
| InChIKey | BPLQIJSMIBHDDW-YLJYHZDGSA-N |
| XLogP | 5.74 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.47 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|