C23H25N3O7 — CID 26744475
(3R,5S)-5-[3-(1,3-benzodioxol-5-yl)-1,2,4-oxadiazol-5-yl]-1-[(2,3,4-trimethoxyphenyl)methyl]pyrrolidin-3-ol (PubChem CID 26744475) has the molecular formula C23H25N3O7 and a molecular weight of 455.47 g/mol. Its IUPAC name is (3R,5S)-5-[3-(1,3-benzodioxol-5-yl)-1,2,4-oxadiazol-5-yl]-1-[(2,3,4-trimethoxyphenyl)methyl]pyrrolidin-3-ol.
| Compound Name | (3R,5S)-5-[3-(1,3-benzodioxol-5-yl)-1,2,4-oxadiazol-5-yl]-1-[(2,3,4-trimethoxyphenyl)methyl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 26744475 |
| Molecular Formula | C23H25N3O7 |
| Molecular Weight | 455.47 g/mol |
| Exact Mass | 455.17 |
| IUPAC Name | (3R,5S)-5-[3-(1,3-benzodioxol-5-yl)-1,2,4-oxadiazol-5-yl]-1-[(2,3,4-trimethoxyphenyl)methyl]pyrrolidin-3-ol |
| SMILES | COc1ccc(CN2C[C@H](O)C[C@H]2c2nc(-c3ccc4c(c3)OCO4)no2)c(OC)c1OC |
| InChI | InChI=1S/C23H25N3O7/c1-28-18-7-5-14(20(29-2)21(18)30-3)10-26-11-15(27)9-16(26)23-24-22(25-33-23)13-4-6-17-19(8-13)32-12-31-17/h4-8,15-16,27H,9-12H2,1-3H3/t15-,16+/m1/s1 |
| InChIKey | FHNXXBJVTZOLQJ-CVEARBPZSA-N |
| XLogP | 2.80 |
| TPSA | 108.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.47 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |