C19H19N4O5- — CID 163121104
(3R,5S)-5-[3-[3-[hydroxy(oxido)amino]phenyl]-1,2,4-oxadiazol-5-yl]-1-[(2-hydroxyphenyl)methyl]pyrrolidin-3-ol (PubChem CID 163121104) has the molecular formula C19H19N4O5- and a molecular weight of 383.38 g/mol. Its IUPAC name is (3R,5S)-5-[3-[3-[hydroxy(oxido)amino]phenyl]-1,2,4-oxadiazol-5-yl]-1-[(2-hydroxyphenyl)methyl]pyrrolidin-3-ol.
| Compound Name | (3R,5S)-5-[3-[3-[hydroxy(oxido)amino]phenyl]-1,2,4-oxadiazol-5-yl]-1-[(2-hydroxyphenyl)methyl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 163121104 |
| Molecular Formula | C19H19N4O5- |
| Molecular Weight | 383.38 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | (3R,5S)-5-[3-[3-[hydroxy(oxido)amino]phenyl]-1,2,4-oxadiazol-5-yl]-1-[(2-hydroxyphenyl)methyl]pyrrolidin-3-ol |
| SMILES | [O-]N(O)c1cccc(-c2noc([C@@H]3C[C@@H](O)CN3Cc3ccccc3O)n2)c1 |
| InChI | InChI=1S/C19H19N4O5/c24-15-9-16(22(11-15)10-13-4-1-2-7-17(13)25)19-20-18(21-28-19)12-5-3-6-14(8-12)23(26)27/h1-8,15-16,24-26H,9-11H2/q-1/t15-,16+/m1/s1 |
| InChIKey | UONSHLYVKNUQDD-CVEARBPZSA-N |
| XLogP | 2.44 |
| TPSA | 129.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.38 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|