C21H20N5O4- — CID 163144954
(3R,5S)-5-[3-[3-[hydroxy(oxido)amino]phenyl]-1,2,4-oxadiazol-5-yl]-1-(1H-indol-3-ylmethyl)pyrrolidin-3-ol (PubChem CID 163144954) has the molecular formula C21H20N5O4- and a molecular weight of 406.42 g/mol. Its IUPAC name is (3R,5S)-5-[3-[3-[hydroxy(oxido)amino]phenyl]-1,2,4-oxadiazol-5-yl]-1-(1H-indol-3-ylmethyl)pyrrolidin-3-ol.
| Compound Name | (3R,5S)-5-[3-[3-[hydroxy(oxido)amino]phenyl]-1,2,4-oxadiazol-5-yl]-1-(1H-indol-3-ylmethyl)pyrrolidin-3-ol |
|---|---|
| PubChem CID | 163144954 |
| Molecular Formula | C21H20N5O4- |
| Molecular Weight | 406.42 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | (3R,5S)-5-[3-[3-[hydroxy(oxido)amino]phenyl]-1,2,4-oxadiazol-5-yl]-1-(1H-indol-3-ylmethyl)pyrrolidin-3-ol |
| SMILES | [O-]N(O)c1cccc(-c2noc([C@@H]3C[C@@H](O)CN3Cc3c[nH]c4ccccc34)n2)c1 |
| InChI | InChI=1S/C21H20N5O4/c27-16-9-19(25(12-16)11-14-10-22-18-7-2-1-6-17(14)18)21-23-20(24-30-21)13-4-3-5-15(8-13)26(28)29/h1-8,10,16,19,22,27-28H,9,11-12H2/q-1/t16-,19+/m1/s1 |
| InChIKey | UZKADBXNOPZPAQ-APWZRJJASA-N |
| XLogP | 3.22 |
| TPSA | 124.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.42 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|