C22H21N5O4 — CID 26744347
(3R,5S)-1-[(1-methylindol-3-yl)methyl]-5-[3-(3-nitrophenyl)-1,2,4-oxadiazol-5-yl]pyrrolidin-3-ol (PubChem CID 26744347) has the molecular formula C22H21N5O4 and a molecular weight of 419.44 g/mol. Its IUPAC name is (3R,5S)-1-[(1-methylindol-3-yl)methyl]-5-[3-(3-nitrophenyl)-1,2,4-oxadiazol-5-yl]pyrrolidin-3-ol.
| Compound Name | (3R,5S)-1-[(1-methylindol-3-yl)methyl]-5-[3-(3-nitrophenyl)-1,2,4-oxadiazol-5-yl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 26744347 |
| Molecular Formula | C22H21N5O4 |
| Molecular Weight | 419.44 g/mol |
| Exact Mass | 419.16 |
| IUPAC Name | (3R,5S)-1-[(1-methylindol-3-yl)methyl]-5-[3-(3-nitrophenyl)-1,2,4-oxadiazol-5-yl]pyrrolidin-3-ol |
| SMILES | Cn1cc(CN2C[C@H](O)C[C@H]2c2nc(-c3cccc([N+](=O)[O-])c3)no2)c2ccccc21 |
| InChI | InChI=1S/C22H21N5O4/c1-25-11-15(18-7-2-3-8-19(18)25)12-26-13-17(28)10-20(26)22-23-21(24-31-22)14-5-4-6-16(9-14)27(29)30/h2-9,11,17,20,28H,10,12-13H2,1H3/t17-,20+/m1/s1 |
| InChIKey | FTNPTCBBWHVABB-XLIONFOSSA-N |
| XLogP | 3.44 |
| TPSA | 110.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.44 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|