C20H18F3N4O4- — CID 163123564
(3R,5S)-5-[3-[3-[hydroxy(oxido)amino]phenyl]-1,2,4-oxadiazol-5-yl]-1-[[4-(trifluoromethyl)phenyl]methyl]pyrrolidin-3-ol (PubChem CID 163123564) has the molecular formula C20H18F3N4O4- and a molecular weight of 435.38 g/mol. Its IUPAC name is (3R,5S)-5-[3-[3-[hydroxy(oxido)amino]phenyl]-1,2,4-oxadiazol-5-yl]-1-[[4-(trifluoromethyl)phenyl]methyl]pyrrolidin-3-ol.
| Compound Name | (3R,5S)-5-[3-[3-[hydroxy(oxido)amino]phenyl]-1,2,4-oxadiazol-5-yl]-1-[[4-(trifluoromethyl)phenyl]methyl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 163123564 |
| Molecular Formula | C20H18F3N4O4- |
| Molecular Weight | 435.38 g/mol |
| Exact Mass | 435.13 |
| IUPAC Name | (3R,5S)-5-[3-[3-[hydroxy(oxido)amino]phenyl]-1,2,4-oxadiazol-5-yl]-1-[[4-(trifluoromethyl)phenyl]methyl]pyrrolidin-3-ol |
| SMILES | [O-]N(O)c1cccc(-c2noc([C@@H]3C[C@@H](O)CN3Cc3ccc(C(F)(F)F)cc3)n2)c1 |
| InChI | InChI=1S/C20H18F3N4O4/c21-20(22,23)14-6-4-12(5-7-14)10-26-11-16(28)9-17(26)19-24-18(25-31-19)13-2-1-3-15(8-13)27(29)30/h1-8,16-17,28-29H,9-11H2/q-1/t16-,17+/m1/s1 |
| InChIKey | OLSIZHWINZHDOC-SJORKVTESA-N |
| XLogP | 3.76 |
| TPSA | 108.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.38 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|