C22H23F3N4O2 — CID 74506588
1-[[4-(dimethylamino)phenyl]methyl]-5-[3-[4-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]pyrrolidin-3-ol (PubChem CID 74506588) has the molecular formula C22H23F3N4O2 and a molecular weight of 432.45 g/mol. Its IUPAC name is 1-[[4-(dimethylamino)phenyl]methyl]-5-[3-[4-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]pyrrolidin-3-ol.
| Compound Name | 1-[[4-(dimethylamino)phenyl]methyl]-5-[3-[4-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 74506588 |
| Molecular Formula | C22H23F3N4O2 |
| Molecular Weight | 432.45 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | 1-[[4-(dimethylamino)phenyl]methyl]-5-[3-[4-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]pyrrolidin-3-ol |
| SMILES | CN(C)c1ccc(CN2CC(O)CC2c2nc(-c3ccc(C(F)(F)F)cc3)no2)cc1 |
| InChI | InChI=1S/C22H23F3N4O2/c1-28(2)17-9-3-14(4-10-17)12-29-13-18(30)11-19(29)21-26-20(27-31-21)15-5-7-16(8-6-15)22(23,24)25/h3-10,18-19,30H,11-13H2,1-2H3 |
| InChIKey | XBZOHASLKVUNOC-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 65.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.45 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|