C22H25FN4O2 — CID 74506718
1-[[4-(dimethylamino)phenyl]methyl]-5-[3-(3-fluoro-4-methylphenyl)-1,2,4-oxadiazol-5-yl]pyrrolidin-3-ol (PubChem CID 74506718) has the molecular formula C22H25FN4O2 and a molecular weight of 396.47 g/mol. Its IUPAC name is 1-[[4-(dimethylamino)phenyl]methyl]-5-[3-(3-fluoro-4-methylphenyl)-1,2,4-oxadiazol-5-yl]pyrrolidin-3-ol.
| Compound Name | 1-[[4-(dimethylamino)phenyl]methyl]-5-[3-(3-fluoro-4-methylphenyl)-1,2,4-oxadiazol-5-yl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 74506718 |
| Molecular Formula | C22H25FN4O2 |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | 1-[[4-(dimethylamino)phenyl]methyl]-5-[3-(3-fluoro-4-methylphenyl)-1,2,4-oxadiazol-5-yl]pyrrolidin-3-ol |
| SMILES | Cc1ccc(-c2noc(C3CC(O)CN3Cc3ccc(N(C)C)cc3)n2)cc1F |
| InChI | InChI=1S/C22H25FN4O2/c1-14-4-7-16(10-19(14)23)21-24-22(29-25-21)20-11-18(28)13-27(20)12-15-5-8-17(9-6-15)26(2)3/h4-10,18,20,28H,11-13H2,1-3H3 |
| InChIKey | IRGNOLSWOVIJLU-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 65.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|