C22H20ClN5O2 — CID 26744932
5-[(6S)-5-[(4-chlorophenyl)methyl]-3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-6-yl]-3-(4-methoxyphenyl)-1,2,4-oxadiazole (PubChem CID 26744932) has the molecular formula C22H20ClN5O2 and a molecular weight of 421.89 g/mol. Its IUPAC name is 5-[(6S)-5-[(4-chlorophenyl)methyl]-3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-6-yl]-3-(4-methoxyphenyl)-1,2,4-oxadiazole.
| Compound Name | 5-[(6S)-5-[(4-chlorophenyl)methyl]-3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-6-yl]-3-(4-methoxyphenyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 26744932 |
| Molecular Formula | C22H20ClN5O2 |
| Molecular Weight | 421.89 g/mol |
| Exact Mass | 421.13 |
| IUPAC Name | 5-[(6S)-5-[(4-chlorophenyl)methyl]-3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-6-yl]-3-(4-methoxyphenyl)-1,2,4-oxadiazole |
| SMILES | COc1ccc(-c2noc([C@@H]3Cc4nc[nH]c4CN3Cc3ccc(Cl)cc3)n2)cc1 |
| InChI | InChI=1S/C22H20ClN5O2/c1-29-17-8-4-15(5-9-17)21-26-22(30-27-21)20-10-18-19(25-13-24-18)12-28(20)11-14-2-6-16(23)7-3-14/h2-9,13,20H,10-12H2,1H3,(H,24,25)/t20-/m0/s1 |
| InChIKey | ICDHHYIOKDJFDA-FQEVSTJZSA-N |
| XLogP | 4.42 |
| TPSA | 80.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.89 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |