C22H25N5O3 — CID 74507741
cyclohexyl-[6-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]-3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]methanone (PubChem CID 74507741) has the molecular formula C22H25N5O3 and a molecular weight of 407.47 g/mol. Its IUPAC name is cyclohexyl-[6-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]-3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]methanone.
| Compound Name | cyclohexyl-[6-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]-3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]methanone |
|---|---|
| PubChem CID | 74507741 |
| Molecular Formula | C22H25N5O3 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.20 |
| IUPAC Name | cyclohexyl-[6-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]-3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]methanone |
| SMILES | COc1ccc(-c2noc(C3Cc4nc[nH]c4CN3C(=O)C3CCCCC3)n2)cc1 |
| InChI | InChI=1S/C22H25N5O3/c1-29-16-9-7-14(8-10-16)20-25-21(30-26-20)19-11-17-18(24-13-23-17)12-27(19)22(28)15-5-3-2-4-6-15/h7-10,13,15,19H,2-6,11-12H2,1H3,(H,23,24) |
| InChIKey | XNBPSULWICSAJN-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 97.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |