C15H13F3N2O5 — CID 26752508
2-(4-methyl-2-oxochromen-7-yl)oxy-N-(2,2,2-trifluoroethylcarbamoyl)acetamide (PubChem CID 26752508) has the molecular formula C15H13F3N2O5 and a molecular weight of 358.27 g/mol. Its IUPAC name is 2-(4-methyl-2-oxochromen-7-yl)oxy-N-(2,2,2-trifluoroethylcarbamoyl)acetamide.
| Compound Name | 2-(4-methyl-2-oxochromen-7-yl)oxy-N-(2,2,2-trifluoroethylcarbamoyl)acetamide |
|---|---|
| PubChem CID | 26752508 |
| Molecular Formula | C15H13F3N2O5 |
| Molecular Weight | 358.27 g/mol |
| Exact Mass | 358.08 |
| IUPAC Name | 2-(4-methyl-2-oxochromen-7-yl)oxy-N-(2,2,2-trifluoroethylcarbamoyl)acetamide |
| SMILES | Cc1cc(=O)oc2cc(OCC(=O)NC(=O)NCC(F)(F)F)ccc12 |
| InChI | InChI=1S/C15H13F3N2O5/c1-8-4-13(22)25-11-5-9(2-3-10(8)11)24-6-12(21)20-14(23)19-7-15(16,17)18/h2-5H,6-7H2,1H3,(H2,19,20,21,23) |
| InChIKey | MUEYNIGJNYNXPK-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.27 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|