C18H25N5O2S2 — CID 26782556
1-tert-butyl-3-[(4-methyl-2-oxo-6-thia-1,8-diazatricyclo[7.5.0.03,7]tetradeca-3(7),4,8-triene-5-carbonyl)amino]thiourea (PubChem CID 26782556) has the molecular formula C18H25N5O2S2 and a molecular weight of 407.57 g/mol. Its IUPAC name is 1-tert-butyl-3-[(4-methyl-2-oxo-6-thia-1,8-diazatricyclo[7.5.0.03,7]tetradeca-3(7),4,8-triene-5-carbonyl)amino]thiourea.
| Compound Name | 1-tert-butyl-3-[(4-methyl-2-oxo-6-thia-1,8-diazatricyclo[7.5.0.03,7]tetradeca-3(7),4,8-triene-5-carbonyl)amino]thiourea |
|---|---|
| PubChem CID | 26782556 |
| Molecular Formula | C18H25N5O2S2 |
| Molecular Weight | 407.57 g/mol |
| Exact Mass | 407.14 |
| IUPAC Name | 1-tert-butyl-3-[(4-methyl-2-oxo-6-thia-1,8-diazatricyclo[7.5.0.03,7]tetradeca-3(7),4,8-triene-5-carbonyl)amino]thiourea |
| SMILES | Cc1c(C(=O)NNC(=S)NC(C)(C)C)sc2nc3n(c(=O)c12)CCCCC3 |
| InChI | InChI=1S/C18H25N5O2S2/c1-10-12-15(19-11-8-6-5-7-9-23(11)16(12)25)27-13(10)14(24)21-22-17(26)20-18(2,3)4/h5-9H2,1-4H3,(H,21,24)(H2,20,22,26) |
| InChIKey | LUFZOMIIPRNONO-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 88.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.57 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|