C19H17Cl3N4O2S — CID 26720801
4-methyl-2-oxo-N'-(2,4,6-trichlorophenyl)-6-thia-1,8-diazatricyclo[7.5.0.03,7]tetradeca-3(7),4,8-triene-5-carbohydrazide (PubChem CID 26720801) has the molecular formula C19H17Cl3N4O2S and a molecular weight of 471.80 g/mol. Its IUPAC name is 4-methyl-2-oxo-N'-(2,4,6-trichlorophenyl)-6-thia-1,8-diazatricyclo[7.5.0.03,7]tetradeca-3(7),4,8-triene-5-carbohydrazide.
| Compound Name | 4-methyl-2-oxo-N'-(2,4,6-trichlorophenyl)-6-thia-1,8-diazatricyclo[7.5.0.03,7]tetradeca-3(7),4,8-triene-5-carbohydrazide |
|---|---|
| PubChem CID | 26720801 |
| Molecular Formula | C19H17Cl3N4O2S |
| Molecular Weight | 471.80 g/mol |
| Exact Mass | 470.01 |
| IUPAC Name | 4-methyl-2-oxo-N'-(2,4,6-trichlorophenyl)-6-thia-1,8-diazatricyclo[7.5.0.03,7]tetradeca-3(7),4,8-triene-5-carbohydrazide |
| SMILES | Cc1c(C(=O)NNc2c(Cl)cc(Cl)cc2Cl)sc2nc3n(c(=O)c12)CCCCC3 |
| InChI | InChI=1S/C19H17Cl3N4O2S/c1-9-14-18(23-13-5-3-2-4-6-26(13)19(14)28)29-16(9)17(27)25-24-15-11(21)7-10(20)8-12(15)22/h7-8,24H,2-6H2,1H3,(H,25,27) |
| InChIKey | YDPPCFSQRPFXMK-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.80 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|