C22H21Cl2N3O4S — CID 42972686
[1-(2,4-dichloroanilino)-1-oxopropan-2-yl] 4-methyl-2-oxo-6-thia-1,8-diazatricyclo[7.5.0.03,7]tetradeca-3(7),4,8-triene-5-carboxylate (PubChem CID 42972686) has the molecular formula C22H21Cl2N3O4S and a molecular weight of 494.40 g/mol. Its IUPAC name is [1-(2,4-dichloroanilino)-1-oxopropan-2-yl] 4-methyl-2-oxo-6-thia-1,8-diazatricyclo[7.5.0.03,7]tetradeca-3(7),4,8-triene-5-carboxylate.
| Compound Name | [1-(2,4-dichloroanilino)-1-oxopropan-2-yl] 4-methyl-2-oxo-6-thia-1,8-diazatricyclo[7.5.0.03,7]tetradeca-3(7),4,8-triene-5-carboxylate |
|---|---|
| PubChem CID | 42972686 |
| Molecular Formula | C22H21Cl2N3O4S |
| Molecular Weight | 494.40 g/mol |
| Exact Mass | 493.06 |
| IUPAC Name | [1-(2,4-dichloroanilino)-1-oxopropan-2-yl] 4-methyl-2-oxo-6-thia-1,8-diazatricyclo[7.5.0.03,7]tetradeca-3(7),4,8-triene-5-carboxylate |
| SMILES | Cc1c(C(=O)OC(C)C(=O)Nc2ccc(Cl)cc2Cl)sc2nc3n(c(=O)c12)CCCCC3 |
| InChI | InChI=1S/C22H21Cl2N3O4S/c1-11-17-20(26-16-6-4-3-5-9-27(16)21(17)29)32-18(11)22(30)31-12(2)19(28)25-15-8-7-13(23)10-14(15)24/h7-8,10,12H,3-6,9H2,1-2H3,(H,25,28) |
| InChIKey | SKLFLORDIAKWDE-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.40 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |