C23H24N2O4S — CID 46796382
[1-oxo-1-(2,4,5-trimethylphenyl)propan-2-yl] 4-methyl-2-oxo-6-thia-1,8-diazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-triene-5-carboxylate (PubChem CID 46796382) has the molecular formula C23H24N2O4S and a molecular weight of 424.52 g/mol. Its IUPAC name is [1-oxo-1-(2,4,5-trimethylphenyl)propan-2-yl] 4-methyl-2-oxo-6-thia-1,8-diazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-triene-5-carboxylate.
| Compound Name | [1-oxo-1-(2,4,5-trimethylphenyl)propan-2-yl] 4-methyl-2-oxo-6-thia-1,8-diazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-triene-5-carboxylate |
|---|---|
| PubChem CID | 46796382 |
| Molecular Formula | C23H24N2O4S |
| Molecular Weight | 424.52 g/mol |
| Exact Mass | 424.15 |
| IUPAC Name | [1-oxo-1-(2,4,5-trimethylphenyl)propan-2-yl] 4-methyl-2-oxo-6-thia-1,8-diazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-triene-5-carboxylate |
| SMILES | Cc1cc(C)c(C(=O)C(C)OC(=O)c2sc3nc4n(c(=O)c3c2C)CCC4)cc1C |
| InChI | InChI=1S/C23H24N2O4S/c1-11-9-13(3)16(10-12(11)2)19(26)15(5)29-23(28)20-14(4)18-21(30-20)24-17-7-6-8-25(17)22(18)27/h9-10,15H,6-8H2,1-5H3 |
| InChIKey | FDWSYYWYIANRJU-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 78.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.52 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |