C20H18N4O6S — CID 46796403
[1-(4-nitroanilino)-1-oxopropan-2-yl] 4-methyl-2-oxo-6-thia-1,8-diazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-triene-5-carboxylate (PubChem CID 46796403) has the molecular formula C20H18N4O6S and a molecular weight of 442.45 g/mol. Its IUPAC name is [1-(4-nitroanilino)-1-oxopropan-2-yl] 4-methyl-2-oxo-6-thia-1,8-diazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-triene-5-carboxylate.
| Compound Name | [1-(4-nitroanilino)-1-oxopropan-2-yl] 4-methyl-2-oxo-6-thia-1,8-diazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-triene-5-carboxylate |
|---|---|
| PubChem CID | 46796403 |
| Molecular Formula | C20H18N4O6S |
| Molecular Weight | 442.45 g/mol |
| Exact Mass | 442.09 |
| IUPAC Name | [1-(4-nitroanilino)-1-oxopropan-2-yl] 4-methyl-2-oxo-6-thia-1,8-diazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-triene-5-carboxylate |
| SMILES | Cc1c(C(=O)OC(C)C(=O)Nc2ccc([N+](=O)[O-])cc2)sc2nc3n(c(=O)c12)CCC3 |
| InChI | InChI=1S/C20H18N4O6S/c1-10-15-18(22-14-4-3-9-23(14)19(15)26)31-16(10)20(27)30-11(2)17(25)21-12-5-7-13(8-6-12)24(28)29/h5-8,11H,3-4,9H2,1-2H3,(H,21,25) |
| InChIKey | NGOOUMAYKFASDG-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 133.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.45 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|