C18H19NO3 — CID 2678306
[(1S)-2-oxocyclopentyl] 2-ethyl-3-methylquinoline-4-carboxylate (PubChem CID 2678306) has the molecular formula C18H19NO3 and a molecular weight of 297.35 g/mol. Its IUPAC name is [(1S)-2-oxocyclopentyl] 2-ethyl-3-methylquinoline-4-carboxylate.
| Compound Name | [(1S)-2-oxocyclopentyl] 2-ethyl-3-methylquinoline-4-carboxylate |
|---|---|
| PubChem CID | 2678306 |
| Molecular Formula | C18H19NO3 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | [(1S)-2-oxocyclopentyl] 2-ethyl-3-methylquinoline-4-carboxylate |
| SMILES | CCc1nc2ccccc2c(C(=O)O[C@H]2CCCC2=O)c1C |
| InChI | InChI=1S/C18H19NO3/c1-3-13-11(2)17(12-7-4-5-8-14(12)19-13)18(21)22-16-10-6-9-15(16)20/h4-5,7-8,16H,3,6,9-10H2,1-2H3/t16-/m0/s1 |
| InChIKey | VRJZQTIEIRFNKP-INIZCTEOSA-N |
| XLogP | 3.38 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |