C15H12FN3O5 — CID 26814603
2-(5-fluoro-2-nitrophenoxy)-N-(phenylcarbamoyl)acetamide (PubChem CID 26814603) has the molecular formula C15H12FN3O5 and a molecular weight of 333.28 g/mol. Its IUPAC name is 2-(5-fluoro-2-nitrophenoxy)-N-(phenylcarbamoyl)acetamide.
| Compound Name | 2-(5-fluoro-2-nitrophenoxy)-N-(phenylcarbamoyl)acetamide |
|---|---|
| PubChem CID | 26814603 |
| Molecular Formula | C15H12FN3O5 |
| Molecular Weight | 333.28 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | 2-(5-fluoro-2-nitrophenoxy)-N-(phenylcarbamoyl)acetamide |
| SMILES | O=C(COc1cc(F)ccc1[N+](=O)[O-])NC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C15H12FN3O5/c16-10-6-7-12(19(22)23)13(8-10)24-9-14(20)18-15(21)17-11-4-2-1-3-5-11/h1-8H,9H2,(H2,17,18,20,21) |
| InChIKey | PWRNTRHAFMREBM-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.28 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|