C15H13N3O2S — CID 26823552
N-(2,1,3-benzothiadiazol-5-yl)-3-ethoxybenzamide (PubChem CID 26823552) has the molecular formula C15H13N3O2S and a molecular weight of 299.36 g/mol. Its IUPAC name is N-(2,1,3-benzothiadiazol-5-yl)-3-ethoxybenzamide.
| Compound Name | N-(2,1,3-benzothiadiazol-5-yl)-3-ethoxybenzamide |
|---|---|
| PubChem CID | 26823552 |
| Molecular Formula | C15H13N3O2S |
| Molecular Weight | 299.36 g/mol |
| Exact Mass | 299.07 |
| IUPAC Name | N-(2,1,3-benzothiadiazol-5-yl)-3-ethoxybenzamide |
| SMILES | CCOc1cccc(C(=O)Nc2ccc3nsnc3c2)c1 |
| InChI | InChI=1S/C15H13N3O2S/c1-2-20-12-5-3-4-10(8-12)15(19)16-11-6-7-13-14(9-11)18-21-17-13/h3-9H,2H2,1H3,(H,16,19) |
| InChIKey | HWKIYXRTJSBRTJ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.36 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |