C21H17N5O4S — CID 26842760
2-[2-(4-methoxyphenyl)imidazo[1,2-b]pyridazin-6-yl]sulfanyl-N-(4-nitrophenyl)acetamide (PubChem CID 26842760) has the molecular formula C21H17N5O4S and a molecular weight of 435.47 g/mol. Its IUPAC name is 2-[2-(4-methoxyphenyl)imidazo[1,2-b]pyridazin-6-yl]sulfanyl-N-(4-nitrophenyl)acetamide.
| Compound Name | 2-[2-(4-methoxyphenyl)imidazo[1,2-b]pyridazin-6-yl]sulfanyl-N-(4-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 26842760 |
| Molecular Formula | C21H17N5O4S |
| Molecular Weight | 435.47 g/mol |
| Exact Mass | 435.10 |
| IUPAC Name | 2-[2-(4-methoxyphenyl)imidazo[1,2-b]pyridazin-6-yl]sulfanyl-N-(4-nitrophenyl)acetamide |
| SMILES | COc1ccc(-c2cn3nc(SCC(=O)Nc4ccc([N+](=O)[O-])cc4)ccc3n2)cc1 |
| InChI | InChI=1S/C21H17N5O4S/c1-30-17-8-2-14(3-9-17)18-12-25-19(23-18)10-11-21(24-25)31-13-20(27)22-15-4-6-16(7-5-15)26(28)29/h2-12H,13H2,1H3,(H,22,27) |
| InChIKey | RRRIUFOTNLAQMM-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 111.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.47 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|