C21H18ClFN2O2 — CID 26843899
1-[(2-chloro-6-fluorophenyl)methyl]-N-(2-ethylphenyl)-6-oxopyridine-3-carboxamide (PubChem CID 26843899) has the molecular formula C21H18ClFN2O2 and a molecular weight of 384.84 g/mol. Its IUPAC name is 1-[(2-chloro-6-fluorophenyl)methyl]-N-(2-ethylphenyl)-6-oxopyridine-3-carboxamide.
| Compound Name | 1-[(2-chloro-6-fluorophenyl)methyl]-N-(2-ethylphenyl)-6-oxopyridine-3-carboxamide |
|---|---|
| PubChem CID | 26843899 |
| Molecular Formula | C21H18ClFN2O2 |
| Molecular Weight | 384.84 g/mol |
| Exact Mass | 384.10 |
| IUPAC Name | 1-[(2-chloro-6-fluorophenyl)methyl]-N-(2-ethylphenyl)-6-oxopyridine-3-carboxamide |
| SMILES | CCc1ccccc1NC(=O)c1ccc(=O)n(Cc2c(F)cccc2Cl)c1 |
| InChI | InChI=1S/C21H18ClFN2O2/c1-2-14-6-3-4-9-19(14)24-21(27)15-10-11-20(26)25(12-15)13-16-17(22)7-5-8-18(16)23/h3-12H,2,13H2,1H3,(H,24,27) |
| InChIKey | DJQIBLCQDDKIRJ-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.84 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |