C22H24N4O3S — CID 2686059
N-[3-[[10-(morpholin-4-ylmethyl)-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl]oxy]phenyl]acetamide (PubChem CID 2686059) has the molecular formula C22H24N4O3S and a molecular weight of 424.53 g/mol. Its IUPAC name is N-[3-[[10-(morpholin-4-ylmethyl)-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl]oxy]phenyl]acetamide.
| Compound Name | N-[3-[[10-(morpholin-4-ylmethyl)-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl]oxy]phenyl]acetamide |
|---|---|
| PubChem CID | 2686059 |
| Molecular Formula | C22H24N4O3S |
| Molecular Weight | 424.53 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | N-[3-[[10-(morpholin-4-ylmethyl)-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl]oxy]phenyl]acetamide |
| SMILES | CC(=O)Nc1cccc(Oc2nc(CN3CCOCC3)nc3sc4c(c23)CCC4)c1 |
| InChI | InChI=1S/C22H24N4O3S/c1-14(27)23-15-4-2-5-16(12-15)29-21-20-17-6-3-7-18(17)30-22(20)25-19(24-21)13-26-8-10-28-11-9-26/h2,4-5,12H,3,6-11,13H2,1H3,(H,23,27) |
| InChIKey | YOOOFJKEIDJCLE-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.53 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |