C22H25N3O2S — CID 2396046
4-[[12-(2,5-dimethylphenoxy)-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-10-yl]methyl]morpholine (PubChem CID 2396046) has the molecular formula C22H25N3O2S and a molecular weight of 395.53 g/mol. Its IUPAC name is 4-[[12-(2,5-dimethylphenoxy)-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-10-yl]methyl]morpholine.
| Compound Name | 4-[[12-(2,5-dimethylphenoxy)-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-10-yl]methyl]morpholine |
|---|---|
| PubChem CID | 2396046 |
| Molecular Formula | C22H25N3O2S |
| Molecular Weight | 395.53 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | 4-[[12-(2,5-dimethylphenoxy)-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-10-yl]methyl]morpholine |
| SMILES | Cc1ccc(C)c(Oc2nc(CN3CCOCC3)nc3sc4c(c23)CCC4)c1 |
| InChI | InChI=1S/C22H25N3O2S/c1-14-6-7-15(2)17(12-14)27-21-20-16-4-3-5-18(16)28-22(20)24-19(23-21)13-25-8-10-26-11-9-25/h6-7,12H,3-5,8-11,13H2,1-2H3 |
| InChIKey | NJBISVCLHVRPFZ-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 47.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.53 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |