C22H26N3O2S+ — CID 9195811
4-[[12-(2,4-dimethylphenoxy)-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-10-yl]methyl]morpholin-4-ium (PubChem CID 9195811) has the molecular formula C22H26N3O2S+ and a molecular weight of 396.54 g/mol. Its IUPAC name is 4-[[12-(2,4-dimethylphenoxy)-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-10-yl]methyl]morpholin-4-ium.
| Compound Name | 4-[[12-(2,4-dimethylphenoxy)-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-10-yl]methyl]morpholin-4-ium |
|---|---|
| PubChem CID | 9195811 |
| Molecular Formula | C22H26N3O2S+ |
| Molecular Weight | 396.54 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | 4-[[12-(2,4-dimethylphenoxy)-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-10-yl]methyl]morpholin-4-ium |
| SMILES | Cc1ccc(Oc2nc(C[NH+]3CCOCC3)nc3sc4c(c23)CCC4)c(C)c1 |
| InChI | InChI=1S/C22H25N3O2S/c1-14-6-7-17(15(2)12-14)27-21-20-16-4-3-5-18(16)28-22(20)24-19(23-21)13-25-8-10-26-11-9-25/h6-7,12H,3-5,8-11,13H2,1-2H3/p+1 |
| InChIKey | ULBUIMYBQGZUTH-UHFFFAOYSA-O |
| XLogP | 3.00 |
| TPSA | 48.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.54 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |