C20H20F2N3O2S+ — CID 9195985
4-[[12-(3,4-difluorophenoxy)-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-10-yl]methyl]morpholin-4-ium (PubChem CID 9195985) has the molecular formula C20H20F2N3O2S+ and a molecular weight of 404.46 g/mol. Its IUPAC name is 4-[[12-(3,4-difluorophenoxy)-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-10-yl]methyl]morpholin-4-ium.
| Compound Name | 4-[[12-(3,4-difluorophenoxy)-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-10-yl]methyl]morpholin-4-ium |
|---|---|
| PubChem CID | 9195985 |
| Molecular Formula | C20H20F2N3O2S+ |
| Molecular Weight | 404.46 g/mol |
| Exact Mass | 404.12 |
| IUPAC Name | 4-[[12-(3,4-difluorophenoxy)-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-10-yl]methyl]morpholin-4-ium |
| SMILES | Fc1ccc(Oc2nc(C[NH+]3CCOCC3)nc3sc4c(c23)CCC4)cc1F |
| InChI | InChI=1S/C20H19F2N3O2S/c21-14-5-4-12(10-15(14)22)27-19-18-13-2-1-3-16(13)28-20(18)24-17(23-19)11-25-6-8-26-9-7-25/h4-5,10H,1-3,6-9,11H2/p+1 |
| InChIKey | AOJVVRUWGHDSGA-UHFFFAOYSA-O |
| XLogP | 2.67 |
| TPSA | 48.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.46 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |