C24H30N3O2S+ — CID 2686647
4-[[(7R)-4-(2,5-dimethylphenoxy)-7-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]methyl]morpholin-4-ium (PubChem CID 2686647) has the molecular formula C24H30N3O2S+ and a molecular weight of 424.59 g/mol. Its IUPAC name is 4-[[(7R)-4-(2,5-dimethylphenoxy)-7-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]methyl]morpholin-4-ium.
| Compound Name | 4-[[(7R)-4-(2,5-dimethylphenoxy)-7-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]methyl]morpholin-4-ium |
|---|---|
| PubChem CID | 2686647 |
| Molecular Formula | C24H30N3O2S+ |
| Molecular Weight | 424.59 g/mol |
| Exact Mass | 424.21 |
| IUPAC Name | 4-[[(7R)-4-(2,5-dimethylphenoxy)-7-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]methyl]morpholin-4-ium |
| SMILES | Cc1ccc(C)c(Oc2nc(C[NH+]3CCOCC3)nc3sc4c(c23)CC[C@@H](C)C4)c1 |
| InChI | InChI=1S/C24H29N3O2S/c1-15-4-6-17(3)19(12-15)29-23-22-18-7-5-16(2)13-20(18)30-24(22)26-21(25-23)14-27-8-10-28-11-9-27/h4,6,12,16H,5,7-11,13-14H2,1-3H3/p+1/t16-/m1/s1 |
| InChIKey | RENDRTRRZQZLQY-MRXNPFEDSA-O |
| XLogP | 3.64 |
| TPSA | 48.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.59 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |