About [(2S)-butan-2-yl] 6-methyl-2-oxo-1H-quinoline-4-carboxylate
[(2S)-butan-2-yl] 6-methyl-2-oxo-1H-quinoline-4-carboxylate (PubChem CID 26870444) has the molecular formula C15H17NO3
and a molecular weight of 259.31 g/mol. Its IUPAC name is [(2S)-butan-2-yl] 6-methyl-2-oxo-1H-quinoline-4-carboxylate.
Molecular Properties
| Compound Name | [(2S)-butan-2-yl] 6-methyl-2-oxo-1H-quinoline-4-carboxylate |
| PubChem CID | 26870444 |
| Molecular Formula | C15H17NO3 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | [(2S)-butan-2-yl] 6-methyl-2-oxo-1H-quinoline-4-carboxylate |
| SMILES | CC[C@H](C)OC(=O)c1cc(=O)[nH]c2ccc(C)cc12 |
| InChI | InChI=1S/C15H17NO3/c1-4-10(3)19-15(18)12-8-14(17)16-13-6-5-9(2)7-11(12)13/h5-8,10H,4H2,1-3H3,(H,16,17)/t10-/m0/s1 |
| InChIKey | ANBPCWCJARHFKM-JTQLQIEISA-N |
| XLogP | 2.79 |
| TPSA | 59.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(2S)-butan-2-yl] 6-methyl-2-oxo-1H-quinoline-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-butan-2-yl] 6-methyl-2-oxo-1H-quinoline-4-carboxylate?
The IUPAC name of [(2S)-butan-2-yl] 6-methyl-2-oxo-1H-quinoline-4-carboxylate (CID 26870444) is [(2S)-butan-2-yl] 6-methyl-2-oxo-1H-quinoline-4-carboxylate.
What is the SMILES notation for [(2S)-butan-2-yl] 6-methyl-2-oxo-1H-quinoline-4-carboxylate?
The canonical SMILES for [(2S)-butan-2-yl] 6-methyl-2-oxo-1H-quinoline-4-carboxylate is CC[C@H](C)OC(=O)c1cc(=O)[nH]c2ccc(C)cc12.
What is the InChIKey of [(2S)-butan-2-yl] 6-methyl-2-oxo-1H-quinoline-4-carboxylate?
The InChIKey is ANBPCWCJARHFKM-JTQLQIEISA-N. The full InChI is InChI=1S/C15H17NO3/c1-4-10(3)19-15(18)12-8-14(17)16-13-6-5-9(2)7-11(12)13/h5-8,10H,4H2,1-3H3,(H,16,17)/t10-/m0/s1.
What are the key properties of [(2S)-butan-2-yl] 6-methyl-2-oxo-1H-quinoline-4-carboxylate?
[(2S)-butan-2-yl] 6-methyl-2-oxo-1H-quinoline-4-carboxylate has a molecular weight of 259.31 g/mol, XLogP of 2.79, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-butan-2-yl] 6-methyl-2-oxo-1H-quinoline-4-carboxylate is sourced from PubChem (CID 26870444), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).