C19H28O7 — CID 87960871
5-butan-2-yloxycarbonyl-2,4-dimethoxy-3-pentan-3-yloxybenzoic acid (PubChem CID 87960871) has the molecular formula C19H28O7 and a molecular weight of 368.43 g/mol. Its IUPAC name is 5-butan-2-yloxycarbonyl-2,4-dimethoxy-3-pentan-3-yloxybenzoic acid.
| Compound Name | 5-butan-2-yloxycarbonyl-2,4-dimethoxy-3-pentan-3-yloxybenzoic acid |
|---|---|
| PubChem CID | 87960871 |
| Molecular Formula | C19H28O7 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | 5-butan-2-yloxycarbonyl-2,4-dimethoxy-3-pentan-3-yloxybenzoic acid |
| SMILES | CCC(C)OC(=O)c1cc(C(=O)O)c(OC)c(OC(CC)CC)c1OC |
| InChI | InChI=1S/C19H28O7/c1-7-11(4)25-19(22)14-10-13(18(20)21)15(23-5)17(16(14)24-6)26-12(8-2)9-3/h10-12H,7-9H2,1-6H3,(H,20,21) |
| InChIKey | BZEKHVHTWAOMJD-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |