C12H14O4 — CID 169444232
2-butan-2-yloxycarbonyl-3,4,5,6-tetradeuteriobenzoic acid (PubChem CID 169444232) has the molecular formula C12H14O4 and a molecular weight of 226.26 g/mol. Its IUPAC name is 2-butan-2-yloxycarbonyl-3,4,5,6-tetradeuteriobenzoic acid.
| Compound Name | 2-butan-2-yloxycarbonyl-3,4,5,6-tetradeuteriobenzoic acid |
|---|---|
| PubChem CID | 169444232 |
| Molecular Formula | C12H14O4 |
| Molecular Weight | 226.26 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | 2-butan-2-yloxycarbonyl-3,4,5,6-tetradeuteriobenzoic acid |
| SMILES | [2H]c1c([2H])c([2H])c(C(=O)OC(C)CC)c(C(=O)O)c1[2H] |
| InChI | InChI=1S/C12H14O4/c1-3-8(2)16-12(15)10-7-5-4-6-9(10)11(13)14/h4-8H,3H2,1-2H3,(H,13,14)/i4D,5D,6D,7D |
| InChIKey | USZVTXIEQADBGH-UGWFXTGHSA-N |
| XLogP | 2.34 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.26 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |