C16H22O4 — CID 169438158
dibutan-2-yl 3,4,5,6-tetradeuteriobenzene-1,2-dicarboxylate (PubChem CID 169438158) has the molecular formula C16H22O4 and a molecular weight of 282.37 g/mol. Its IUPAC name is dibutan-2-yl 3,4,5,6-tetradeuteriobenzene-1,2-dicarboxylate.
| Compound Name | dibutan-2-yl 3,4,5,6-tetradeuteriobenzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 169438158 |
| Molecular Formula | C16H22O4 |
| Molecular Weight | 282.37 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | dibutan-2-yl 3,4,5,6-tetradeuteriobenzene-1,2-dicarboxylate |
| SMILES | [2H]c1c([2H])c([2H])c(C(=O)OC(C)CC)c(C(=O)OC(C)CC)c1[2H] |
| InChI | InChI=1S/C16H22O4/c1-5-11(3)19-15(17)13-9-7-8-10-14(13)16(18)20-12(4)6-2/h7-12H,5-6H2,1-4H3/i7D,8D,9D,10D |
| InChIKey | HAPGVMADJBQOGC-ULDPCNCHSA-N |
| XLogP | 3.60 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.37 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |