C16H20O6 — CID 71750783
2-(5-carboxy-2-ethylpentoxy)carbonyl-3,4,5,6-tetradeuteriobenzoic acid (PubChem CID 71750783) has the molecular formula C16H20O6 and a molecular weight of 312.35 g/mol. Its IUPAC name is 2-(5-carboxy-2-ethylpentoxy)carbonyl-3,4,5,6-tetradeuteriobenzoic acid.
| Compound Name | 2-(5-carboxy-2-ethylpentoxy)carbonyl-3,4,5,6-tetradeuteriobenzoic acid |
|---|---|
| PubChem CID | 71750783 |
| Molecular Formula | C16H20O6 |
| Molecular Weight | 312.35 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | 2-(5-carboxy-2-ethylpentoxy)carbonyl-3,4,5,6-tetradeuteriobenzoic acid |
| SMILES | [2H]c1c([2H])c([2H])c(C(=O)OCC(CC)CCCC(=O)O)c(C(=O)O)c1[2H] |
| InChI | InChI=1S/C16H20O6/c1-2-11(6-5-9-14(17)18)10-22-16(21)13-8-4-3-7-12(13)15(19)20/h3-4,7-8,11H,2,5-6,9-10H2,1H3,(H,17,18)(H,19,20)/i3D,4D,7D,8D |
| InChIKey | XFGRNAPKLGXDGF-KNIGXJNHSA-N |
| XLogP | 2.82 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.35 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |