C14H14N2O2 — CID 26871453
N-[(Z)-furan-3-ylmethylideneamino]-3,4-dimethylbenzamide (PubChem CID 26871453) has the molecular formula C14H14N2O2 and a molecular weight of 242.28 g/mol. Its IUPAC name is N-[(Z)-furan-3-ylmethylideneamino]-3,4-dimethylbenzamide.
| Compound Name | N-[(Z)-furan-3-ylmethylideneamino]-3,4-dimethylbenzamide |
|---|---|
| PubChem CID | 26871453 |
| Molecular Formula | C14H14N2O2 |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | N-[(Z)-furan-3-ylmethylideneamino]-3,4-dimethylbenzamide |
| SMILES | Cc1ccc(C(=O)N/N=C\c2ccoc2)cc1C |
| InChI | InChI=1S/C14H14N2O2/c1-10-3-4-13(7-11(10)2)14(17)16-15-8-12-5-6-18-9-12/h3-9H,1-2H3,(H,16,17)/b15-8- |
| InChIKey | JQYLHQXGXNBYDC-NVNXTCNLSA-N |
| XLogP | 2.66 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|