C16H9F4N3O — CID 2688154
N'-(2,3,5,6-tetrafluorophenyl)quinoline-2-carbohydrazide (PubChem CID 2688154) has the molecular formula C16H9F4N3O and a molecular weight of 335.26 g/mol. Its IUPAC name is N'-(2,3,5,6-tetrafluorophenyl)quinoline-2-carbohydrazide.
| Compound Name | N'-(2,3,5,6-tetrafluorophenyl)quinoline-2-carbohydrazide |
|---|---|
| PubChem CID | 2688154 |
| Molecular Formula | C16H9F4N3O |
| Molecular Weight | 335.26 g/mol |
| Exact Mass | 335.07 |
| IUPAC Name | N'-(2,3,5,6-tetrafluorophenyl)quinoline-2-carbohydrazide |
| SMILES | O=C(NNc1c(F)c(F)cc(F)c1F)c1ccc2ccccc2n1 |
| InChI | InChI=1S/C16H9F4N3O/c17-9-7-10(18)14(20)15(13(9)19)22-23-16(24)12-6-5-8-3-1-2-4-11(8)21-12/h1-7,22H,(H,23,24) |
| InChIKey | YZFDSRVARFKWSM-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.26 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|