C20H12ClF5N2O2 — CID 26886312
2-[(2-chlorophenyl)methoxy]-N'-(2,3,4,5,6-pentafluorophenyl)benzohydrazide (PubChem CID 26886312) has the molecular formula C20H12ClF5N2O2 and a molecular weight of 442.77 g/mol. Its IUPAC name is 2-[(2-chlorophenyl)methoxy]-N'-(2,3,4,5,6-pentafluorophenyl)benzohydrazide.
| Compound Name | 2-[(2-chlorophenyl)methoxy]-N'-(2,3,4,5,6-pentafluorophenyl)benzohydrazide |
|---|---|
| PubChem CID | 26886312 |
| Molecular Formula | C20H12ClF5N2O2 |
| Molecular Weight | 442.77 g/mol |
| Exact Mass | 442.05 |
| IUPAC Name | 2-[(2-chlorophenyl)methoxy]-N'-(2,3,4,5,6-pentafluorophenyl)benzohydrazide |
| SMILES | O=C(NNc1c(F)c(F)c(F)c(F)c1F)c1ccccc1OCc1ccccc1Cl |
| InChI | InChI=1S/C20H12ClF5N2O2/c21-12-7-3-1-5-10(12)9-30-13-8-4-2-6-11(13)20(29)28-27-19-17(25)15(23)14(22)16(24)18(19)26/h1-8,27H,9H2,(H,28,29) |
| InChIKey | OQPJFQWDVORIAD-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.77 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|